CAS 157368-32-6 is the registry number for 3-Chloro-6-methoxy-benzo(d)isoxazole. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-chloro-6-methoxy-1,2-benzoxazole (CAS 157368-32-6) is a chemical compound with the molecular formula C8H6ClNO2 and a molecular weight of 183.59 g/mol. IUPAC name: 3-chloro-6-methoxy-1,2-benzoxazole. InChIKey: WPEIANAOXQFSGV-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO2 |
|---|---|
| Molecular weight | 183.59 g/mol |
| IUPAC name | 3-chloro-6-methoxy-1,2-benzoxazole |
| InChIKey | WPEIANAOXQFSGV-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=NO2)Cl |
Computed by PubChem (NCBI)