CAS 157429-08-8 is the registry number for 4-(4-Fluorophenyl)oxazol-2-amine, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
4-(4-fluorophenyl)-1,3-oxazol-2-amine (CAS 157429-08-8) is a chemical compound with the molecular formula C9H7FN2O and a molecular weight of 178.16 g/mol. IUPAC name: 4-(4-fluorophenyl)-1,3-oxazol-2-amine. InChIKey: ANTIKVAJAUKENU-UHFFFAOYSA-N.
| Molecular formula | C9H7FN2O |
|---|---|
| Molecular weight | 178.16 g/mol |
| IUPAC name | 4-(4-fluorophenyl)-1,3-oxazol-2-amine |
| InChIKey | ANTIKVAJAUKENU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=COC(=N2)N)F |
Computed by PubChem (NCBI)