Products 157554-49-9
CAS 157554-49-9 is the registry number for 3,4-Diamino-5-(trifluoromethyl)benzonitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3,4-diamino-5-(trifluoromethyl)benzonitrile (CAS 157554-49-9) is a chemical compound with the molecular formula C8H6F3N3 and a molecular weight of 201.15 g/mol. IUPAC name: 3,4-diamino-5-(trifluoromethyl)benzonitrile. InChIKey: ZKIFWZKDVRJGBA-UHFFFAOYSA-N.
| Molecular formula | C8H6F3N3 |
|---|---|
| Molecular weight | 201.15 g/mol |
| IUPAC name | 3,4-diamino-5-(trifluoromethyl)benzonitrile |
| InChIKey | ZKIFWZKDVRJGBA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)N)N)C#N |
Computed by PubChem (NCBI)