CAS 157604-84-7 appears in our catalog under these names: (trans-1-Benzylpyrrolidine-2,5-diyl)dimethanol, 98%, rel-((2R,5R)-1-Benzylpyrrolidine-2,5-diyl)dimethanol, 98%. Offered by: AmBeed, Fluorochem, Chemat. Available pack sizes: 1g, 100mg, 250mg.
[(2S,5S)-1-benzyl-5-(hydroxymethyl)pyrrolidin-2-yl]methanol (CAS 157604-84-7) is a chemical compound with the molecular formula C13H19NO2 and a molecular weight of 221.29 g/mol. IUPAC name: [(2S,5S)-1-benzyl-5-(hydroxymethyl)pyrrolidin-2-yl]methanol. InChIKey: KDHJNPHFSBLEMM-STQMWFEESA-N.
| Molecular formula | C13H19NO2 |
|---|---|
| Molecular weight | 221.29 g/mol |
| IUPAC name | [(2S,5S)-1-benzyl-5-(hydroxymethyl)pyrrolidin-2-yl]methanol |
| InChIKey | KDHJNPHFSBLEMM-STQMWFEESA-N |
| SMILES | C1C[C@H](N([C@@H]1CO)CC2=CC=CC=C2)CO |
Computed by PubChem (NCBI)