CAS 1579-72-2 is the registry number for 2,2,2-Trifluoroethyl benzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2,2-trifluoroethyl benzoate (CAS 1579-72-2) is a chemical compound with the molecular formula C9H7F3O2 and a molecular weight of 204.15 g/mol. IUPAC name: 2,2,2-trifluoroethyl benzoate. InChIKey: GMYUKHZXDVBIQE-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O2 |
|---|---|
| Molecular weight | 204.15 g/mol |
| IUPAC name | 2,2,2-trifluoroethyl benzoate |
| InChIKey | GMYUKHZXDVBIQE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OCC(F)(F)F |
Computed by PubChem (NCBI)