Products 1579835-49-6
CAS 1579835-49-6 is the registry number for N-Methyl-N-(4-(trifluoromethyl)benzyl)glycine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[methyl-[[4-(trifluoromethyl)phenyl]methyl]amino]acetic acid;hydrochloride (CAS 1579835-49-6) is a chemical compound with the molecular formula C11H13ClF3NO2 and a molecular weight of 283.67 g/mol. IUPAC name: 2-[methyl-[[4-(trifluoromethyl)phenyl]methyl]amino]acetic acid;hydrochloride. InChIKey: NPHGYLCLXUJAIO-UHFFFAOYSA-N.
| Molecular formula | C11H13ClF3NO2 |
|---|---|
| Molecular weight | 283.67 g/mol |
| IUPAC name | 2-[methyl-[[4-(trifluoromethyl)phenyl]methyl]amino]acetic acid;hydrochloride |
| InChIKey | NPHGYLCLXUJAIO-UHFFFAOYSA-N |
| SMILES | CN(CC1=CC=C(C=C1)C(F)(F)F)CC(=O)O.Cl |
Computed by PubChem (NCBI)