Products 1580464-66-9

CAS 1580464-66-9 is the registry number for 6-Pentafluoroethylpyridine-2-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

Methyl 6-(1,1,2,2,2-pentafluoroethyl)pyridine-2-carboxylate (CAS 1580464-66-9) is a chemical compound with the molecular formula C9H6F5NO2 and a molecular weight of 255.14 g/mol. IUPAC name: methyl 6-(1,1,2,2,2-pentafluoroethyl)pyridine-2-carboxylate. InChIKey: YITPQEHOHMDEBU-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6F5NO2
Molecular weight255.14 g/mol
IUPAC namemethyl 6-(1,1,2,2,2-pentafluoroethyl)pyridine-2-carboxylate
InChIKeyYITPQEHOHMDEBU-UHFFFAOYSA-N
SMILESCOC(=O)C1=NC(=CC=C1)C(C(F)(F)F)(F)F

Computed by PubChem (NCBI)