CAS 1580464-66-9 is the registry number for 6-Pentafluoroethylpyridine-2-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
Methyl 6-(1,1,2,2,2-pentafluoroethyl)pyridine-2-carboxylate (CAS 1580464-66-9) is a chemical compound with the molecular formula C9H6F5NO2 and a molecular weight of 255.14 g/mol. IUPAC name: methyl 6-(1,1,2,2,2-pentafluoroethyl)pyridine-2-carboxylate. InChIKey: YITPQEHOHMDEBU-UHFFFAOYSA-N.
| Molecular formula | C9H6F5NO2 |
|---|---|
| Molecular weight | 255.14 g/mol |
| IUPAC name | methyl 6-(1,1,2,2,2-pentafluoroethyl)pyridine-2-carboxylate |
| InChIKey | YITPQEHOHMDEBU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC(=CC=C1)C(C(F)(F)F)(F)F |
Computed by PubChem (NCBI)