CAS 3321-96-8 appears in our catalog under these names: 2-Amino-3-pentafluorophenyl-propionic acid, 95%, 2-Amino-3-(perfluorophenyl)propanoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
2-amino-3-(2,3,4,5,6-pentafluorophenyl)propanoic acid (CAS 3321-96-8) is a chemical compound with the molecular formula C9H6F5NO2 and a molecular weight of 255.14 g/mol. IUPAC name: 2-amino-3-(2,3,4,5,6-pentafluorophenyl)propanoic acid. InChIKey: YYTDJPUFAVPHQA-UHFFFAOYSA-N.
| Molecular formula | C9H6F5NO2 |
|---|---|
| Molecular weight | 255.14 g/mol |
| IUPAC name | 2-amino-3-(2,3,4,5,6-pentafluorophenyl)propanoic acid |
| InChIKey | YYTDJPUFAVPHQA-UHFFFAOYSA-N |
| SMILES | C(C1=C(C(=C(C(=C1F)F)F)F)F)C(C(=O)O)N |
Computed by PubChem (NCBI)