CAS 923200-20-8 appears in our catalog under these names: 2,2,2-Trifluoroethyl 2,4-difluorophenylcarbamate, 95%, 2,2,2-Trifluoroethyl N-(2,4-difluorophenyl)carbamate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2,2,2-trifluoroethyl N-(2,4-difluorophenyl)carbamate (CAS 923200-20-8) is a chemical compound with the molecular formula C9H6F5NO2 and a molecular weight of 255.14 g/mol. IUPAC name: 2,2,2-trifluoroethyl N-(2,4-difluorophenyl)carbamate. InChIKey: ATPSBSXDXBFCBE-UHFFFAOYSA-N.
| Molecular formula | C9H6F5NO2 |
|---|---|
| Molecular weight | 255.14 g/mol |
| IUPAC name | 2,2,2-trifluoroethyl N-(2,4-difluorophenyl)carbamate |
| InChIKey | ATPSBSXDXBFCBE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)NC(=O)OCC(F)(F)F |
Computed by PubChem (NCBI)