CAS 40332-58-9 is the registry number for H-D-Phe(F5)-OH. Offered by: Iris Biotech. Available pack sizes: 1g, 5g, 250mg.
(2R)-2-amino-3-(2,3,4,5,6-pentafluorophenyl)propanoic acid (CAS 40332-58-9) is a chemical compound with the molecular formula C9H6F5NO2 and a molecular weight of 255.14 g/mol. IUPAC name: (2R)-2-amino-3-(2,3,4,5,6-pentafluorophenyl)propanoic acid. InChIKey: YYTDJPUFAVPHQA-GSVOUGTGSA-N.
| Molecular formula | C9H6F5NO2 |
|---|---|
| Molecular weight | 255.14 g/mol |
| IUPAC name | (2R)-2-amino-3-(2,3,4,5,6-pentafluorophenyl)propanoic acid |
| InChIKey | YYTDJPUFAVPHQA-GSVOUGTGSA-N |
| SMILES | C(C1=C(C(=C(C(=C1F)F)F)F)F)[C@H](C(=O)O)N |
Computed by PubChem (NCBI)