CAS 158686-46-5 appears in our catalog under these names: Methyl 4–iodo–L–phenylalaninate hydrochloride, Methyl 4-Iodo-L-Phenylalaninate Hydrochloride, 95%, 95%, Methyl 4-iodo-L-phenylalaninate (hydrochloride), 97.0%, METHYL (S)-2-AMINO-3-(4-IODOPHENYL)PROPANOATE HYDROCHLORIDE, 95%. Offered by: GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1g, 10g, 25g, 5g, 100mg, 250mg, 10 g, 25 g.
Methyl (2S)-2-amino-3-(4-iodophenyl)propanoate;hydrochloride (CAS 158686-46-5) is a chemical compound with the molecular formula C10H13ClINO2 and a molecular weight of 341.57 g/mol. IUPAC name: methyl (2S)-2-amino-3-(4-iodophenyl)propanoate;hydrochloride. InChIKey: CHZRNEAGNQBUSL-FVGYRXGTSA-N.
| Molecular formula | C10H13ClINO2 |
|---|---|
| Molecular weight | 341.57 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(4-iodophenyl)propanoate;hydrochloride |
| InChIKey | CHZRNEAGNQBUSL-FVGYRXGTSA-N |
| SMILES | COC(=O)[C@H](CC1=CC=C(C=C1)I)N.Cl |
Computed by PubChem (NCBI)