Products 269396-70-5
CAS 269396-70-5 appears in our catalog under these names: Benzenebutanoic acid, beta-amino-4-iodo-, (betar)-, 95%, (R)-3-Amino-4-(4-iodophenyl)butanoic acid hydrochloride, 95%, (R)-3-Amino-4-(4-iodophenyl)butanoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg.
(3R)-3-amino-4-(4-iodophenyl)butanoic acid;hydrochloride (CAS 269396-70-5) is a chemical compound with the molecular formula C10H13ClINO2 and a molecular weight of 341.57 g/mol. IUPAC name: (3R)-3-amino-4-(4-iodophenyl)butanoic acid;hydrochloride. InChIKey: OEKGKNIRLMPHEI-SBSPUUFOSA-N.
| Molecular formula | C10H13ClINO2 |
|---|---|
| Molecular weight | 341.57 g/mol |
| IUPAC name | (3R)-3-amino-4-(4-iodophenyl)butanoic acid;hydrochloride |
| InChIKey | OEKGKNIRLMPHEI-SBSPUUFOSA-N |
| SMILES | C1=CC(=CC=C1C[C@H](CC(=O)O)N)I.Cl |
Computed by PubChem (NCBI)
Synonyms:
(3R)-3-amino-4-(4-iodophenyl)butanoic acid;hydrochloride, Benzenebutanoic acid, beta-amino-4-iodo-, (betar)-, C10H13ClINO2, (R)-3-amino-4-(4-iodo-phenyl)-butyric acid-HCl, H-D-beta-HPhe(4-I)-OH HCl, (R)-3-Amino-4-(4-iodo-phenyl)-butyric acid HCl, (3R)-3-Amino-4-(4-iodophenyl)butanoic acid--hydrogen chloride (1/1)