CAS 332061-75-3 is the registry number for (S)–3–Amino–4–(4–iodophenyl)butanoic acid hydrochloride. Offered by: GLPBio. Available pack sizes: 100mg.
(3S)-3-amino-4-(4-iodophenyl)butanoic acid;hydrochloride (CAS 332061-75-3) is a chemical compound with the molecular formula C10H13ClINO2 and a molecular weight of 341.57 g/mol. IUPAC name: (3S)-3-amino-4-(4-iodophenyl)butanoic acid;hydrochloride. InChIKey: OEKGKNIRLMPHEI-FVGYRXGTSA-N.
| Molecular formula | C10H13ClINO2 |
|---|---|
| Molecular weight | 341.57 g/mol |
| IUPAC name | (3S)-3-amino-4-(4-iodophenyl)butanoic acid;hydrochloride |
| InChIKey | OEKGKNIRLMPHEI-FVGYRXGTSA-N |
| SMILES | C1=CC(=CC=C1C[C@@H](CC(=O)O)N)I.Cl |
Computed by PubChem (NCBI)