Products 270065-70-8
CAS 270065-70-8 appears in our catalog under these names: (S)-3-Amino-4-(4-iodophenyl)butanoic acid hydrochloride, 95%, H-β-HoPhe(4-I)-OH, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
(3S)-3-amino-4-(4-iodophenyl)butanoic acid;hydrochloride (CAS 270065-70-8) is a chemical compound with the molecular formula C10H13ClINO2 and a molecular weight of 341.57 g/mol. IUPAC name: (3S)-3-amino-4-(4-iodophenyl)butanoic acid;hydrochloride. InChIKey: OEKGKNIRLMPHEI-FVGYRXGTSA-N.
| Molecular formula | C10H13ClINO2 |
|---|---|
| Molecular weight | 341.57 g/mol |
| IUPAC name | (3S)-3-amino-4-(4-iodophenyl)butanoic acid;hydrochloride |
| InChIKey | OEKGKNIRLMPHEI-FVGYRXGTSA-N |
| SMILES | C1=CC(=CC=C1C[C@@H](CC(=O)O)N)I.Cl |
Computed by PubChem (NCBI)
Synonyms:
(3S)-3-amino-4-(4-iodophenyl)butanoic acid;hydrochloride, (S)-3-amino-4-(4-iodo-phenyl)-butyric acid-HCl, (S)-3-Amino-4-(4-iodophenyl)butanoic acid, HCl, (3S)-3-amino-4-(4-iodophenyl)butanoic Acid Hydrochloride, C10H13ClINO2, H-beta-HPhe(4-I)-OH HCl, (S)-3-Amino-4-(4-iodo-phenyl)-butyric acid hydrochloride, (3S)-3-Amino-4-(4-iodophenyl)butanoic acid--hydrogen chloride (1/1)