CAS 25208-32-6 appears in our catalog under these names: 4-Chloro alpha-Carboline, 4-Chloro-9H-pyrido(2,3-b)indole, 4-Chloro-9H-pyrido[2,3-b]indole 97%, 4-chloro-9H-pyrido[2,3-b]indole, 97%, 97%. Offered by: TRC, Biosynth, Ambeed, Chemat. Available pack sizes: 100mg, 0,5g, 0,25g, 1g, 5g, 250mg.
4-chloro-9H-pyrido[2,3-b]indole (CAS 25208-32-6) is a chemical compound with the molecular formula C11H7ClN2 and a molecular weight of 202.64 g/mol. IUPAC name: 4-chloro-9H-pyrido[2,3-b]indole. InChIKey: HPSXHMSNDHDHJK-UHFFFAOYSA-N.
| Molecular formula | C11H7ClN2 |
|---|---|
| Molecular weight | 202.64 g/mol |
| IUPAC name | 4-chloro-9H-pyrido[2,3-b]indole |
| InChIKey | HPSXHMSNDHDHJK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C=CN=C3N2)Cl |
Computed by PubChem (NCBI)