Products 158704-02-0
CAS 158704-02-0 appears in our catalog under these names: (+)–Dihydrexidine hydrochloride, Dihydrexidine hydrochloride, (+)-Dihydrexidine (hydrochloride). Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 25mg, 5mg, 50mg, Get quote.
(6aR,12bS)-5,6,6a,7,8,12b-hexahydrobenzo[a]phenanthridine-10,11-diol;hydrochloride (CAS 158704-02-0) is a chemical compound with the molecular formula C17H18ClNO2 and a molecular weight of 303.8 g/mol. IUPAC name: (6aR,12bS)-5,6,6a,7,8,12b-hexahydrobenzo[a]phenanthridine-10,11-diol;hydrochloride. InChIKey: IJYUPBNUPIRQEP-SATBOSKTSA-N.
| Molecular formula | C17H18ClNO2 |
|---|---|
| Molecular weight | 303.8 g/mol |
| IUPAC name | (6aR,12bS)-5,6,6a,7,8,12b-hexahydrobenzo[a]phenanthridine-10,11-diol;hydrochloride |
| InChIKey | IJYUPBNUPIRQEP-SATBOSKTSA-N |
| SMILES | C1CC2=CC(=C(C=C2[C@@H]3[C@@H]1NCC4=CC=CC=C34)O)O.Cl |
Computed by PubChem (NCBI)