Products 1590409-56-5
CAS 1590409-56-5 is the registry number for Ethyl 6-hydroxythieno[2,3-b]pyridine-2-carboxylate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 6-oxo-7H-thieno[2,3-b]pyridine-2-carboxylate (CAS 1590409-56-5) is a chemical compound with the molecular formula C10H9NO3S and a molecular weight of 223.25 g/mol. IUPAC name: ethyl 6-oxo-7H-thieno[2,3-b]pyridine-2-carboxylate. InChIKey: UMIGJKFVTOZTPE-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3S |
|---|---|
| Molecular weight | 223.25 g/mol |
| IUPAC name | ethyl 6-oxo-7H-thieno[2,3-b]pyridine-2-carboxylate |
| InChIKey | UMIGJKFVTOZTPE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(S1)NC(=O)C=C2 |
Computed by PubChem (NCBI)