CAS 15905-18-7 appears in our catalog under these names: 3-Methoxycarbonylpyridine N-oxide, 95-<97%, 3-Methoxycarbonylpyridine N-oxide, ≥97-<99%, 3-(Methoxycarbonyl)pyridine 1-oxide, 97%, 97%. Offered by: Hoffman Fine Chemicals, Chemat. Available pack sizes: 10g, 25g, 50g, 100g, 100mg, 250mg, 1g.
Methyl 1-oxidopyridin-1-ium-3-carboxylate (CAS 15905-18-7) is a chemical compound with the molecular formula C7H7NO3 and a molecular weight of 153.14 g/mol. IUPAC name: methyl 1-oxidopyridin-1-ium-3-carboxylate. InChIKey: RVBKAFFMAQAFGK-UHFFFAOYSA-N.
| Molecular formula | C7H7NO3 |
|---|---|
| Molecular weight | 153.14 g/mol |
| IUPAC name | methyl 1-oxidopyridin-1-ium-3-carboxylate |
| InChIKey | RVBKAFFMAQAFGK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C[N+](=CC=C1)[O-] |
Computed by PubChem (NCBI)