CAS 159112-23-9 is the registry number for Baclofen Impurity 18. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4-chlorophenyl)-4-nitrobutanoic acid (CAS 159112-23-9) is a chemical compound with the molecular formula C10H10ClNO4 and a molecular weight of 243.64 g/mol. IUPAC name: 3-(4-chlorophenyl)-4-nitrobutanoic acid. InChIKey: KYJIWWFRFAYPGO-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO4 |
|---|---|
| Molecular weight | 243.64 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-4-nitrobutanoic acid |
| InChIKey | KYJIWWFRFAYPGO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(CC(=O)O)C[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)