Products 159112-23-9

CAS 159112-23-9 is the registry number for Baclofen Impurity 18. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(4-chlorophenyl)-4-nitrobutanoic acid (CAS 159112-23-9) is a chemical compound with the molecular formula C10H10ClNO4 and a molecular weight of 243.64 g/mol. IUPAC name: 3-(4-chlorophenyl)-4-nitrobutanoic acid. InChIKey: KYJIWWFRFAYPGO-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10ClNO4
Molecular weight243.64 g/mol
IUPAC name3-(4-chlorophenyl)-4-nitrobutanoic acid
InChIKeyKYJIWWFRFAYPGO-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C(CC(=O)O)C[N+](=O)[O-])Cl

Computed by PubChem (NCBI)