CAS 15912-56-8 appears in our catalog under these names: H-Tic-Oet.HCl 95%, H-Tic-Oet.HCl, 95%, 95%, Ethyl (S)-1,2,3,4-tetrahydroisoquinoline-3-carboxylate hydrochloride, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
Ethyl (3S)-1,2,3,4-tetrahydroisoquinoline-3-carboxylate;hydrochloride (CAS 15912-56-8) is a chemical compound with the molecular formula C12H16ClNO2 and a molecular weight of 241.71 g/mol. IUPAC name: ethyl (3S)-1,2,3,4-tetrahydroisoquinoline-3-carboxylate;hydrochloride. InChIKey: GKLWWGAFDIKVQY-MERQFXBCSA-N.
| Molecular formula | C12H16ClNO2 |
|---|---|
| Molecular weight | 241.71 g/mol |
| IUPAC name | ethyl (3S)-1,2,3,4-tetrahydroisoquinoline-3-carboxylate;hydrochloride |
| InChIKey | GKLWWGAFDIKVQY-MERQFXBCSA-N |
| SMILES | CCOC(=O)[C@@H]1CC2=CC=CC=C2CN1.Cl |
Computed by PubChem (NCBI)