CAS 1592407-70-9 is the registry number for 3-Bromo-5,7-dimethoxyquinolin-4(1H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-5,7-dimethoxy-1H-quinolin-4-one (CAS 1592407-70-9) is a chemical compound with the molecular formula C11H10BrNO3 and a molecular weight of 284.11 g/mol. IUPAC name: 3-bromo-5,7-dimethoxy-1H-quinolin-4-one. InChIKey: ZDSLMURIMUEGMW-UHFFFAOYSA-N.
| Molecular formula | C11H10BrNO3 |
|---|---|
| Molecular weight | 284.11 g/mol |
| IUPAC name | 3-bromo-5,7-dimethoxy-1H-quinolin-4-one |
| InChIKey | ZDSLMURIMUEGMW-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C(=C1)OC)C(=O)C(=CN2)Br |
Computed by PubChem (NCBI)