Products 1592899-44-9

CAS 1592899-44-9 is the registry number for Ethyl 2,2-dimethylthiomorpholine-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 2,2-dimethylthiomorpholine-4-carboxylate (CAS 1592899-44-9) is a chemical compound with the molecular formula C9H17NO2S and a molecular weight of 203.30 g/mol. IUPAC name: ethyl 2,2-dimethylthiomorpholine-4-carboxylate. InChIKey: RVELFBJWSMSAMR-UHFFFAOYSA-N.

Identity
Molecular formulaC9H17NO2S
Molecular weight203.30 g/mol
IUPAC nameethyl 2,2-dimethylthiomorpholine-4-carboxylate
InChIKeyRVELFBJWSMSAMR-UHFFFAOYSA-N
SMILESCCOC(=O)N1CCSC(C1)(C)C

Computed by PubChem (NCBI)