Products 1593360-88-3
CAS 1593360-88-3 is the registry number for 5-Bromo-7-methoxy-2-methyl-3,4-dihydroquinazolin-4-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-bromo-7-methoxy-2-methyl-3H-quinazolin-4-one (CAS 1593360-88-3) is a chemical compound with the molecular formula C10H9BrN2O2 and a molecular weight of 269.09 g/mol. IUPAC name: 5-bromo-7-methoxy-2-methyl-3H-quinazolin-4-one. InChIKey: MIKGQBQRCHQXKI-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O2 |
|---|---|
| Molecular weight | 269.09 g/mol |
| IUPAC name | 5-bromo-7-methoxy-2-methyl-3H-quinazolin-4-one |
| InChIKey | MIKGQBQRCHQXKI-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C(=CC(=C2)OC)Br)C(=O)N1 |
Computed by PubChem (NCBI)