Products 1593590-12-5
CAS 1593590-12-5 is the registry number for N-(4-Aminophenyl)-1,3-dioxaindane-5-carboxamide. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
N-(4-aminophenyl)-1,3-benzodioxole-5-carboxamide (CAS 1593590-12-5) is a chemical compound with the molecular formula C14H12N2O3 and a molecular weight of 256.26 g/mol. IUPAC name: N-(4-aminophenyl)-1,3-benzodioxole-5-carboxamide. InChIKey: NFGHWVUTZLBVJE-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O3 |
|---|---|
| Molecular weight | 256.26 g/mol |
| IUPAC name | N-(4-aminophenyl)-1,3-benzodioxole-5-carboxamide |
| InChIKey | NFGHWVUTZLBVJE-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C(=O)NC3=CC=C(C=C3)N |
Computed by PubChem (NCBI)