CAS 1594056-86-6 appears in our catalog under these names: 5-(Difluoromethoxy)quinolin-8-amine, 95%, 5-(Difluoromethoxy)quinolin-8-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,05g, 0,1g, 0,25g, 0,5g.
5-(difluoromethoxy)quinolin-8-amine (CAS 1594056-86-6) is a chemical compound with the molecular formula C10H8F2N2O and a molecular weight of 210.18 g/mol. IUPAC name: 5-(difluoromethoxy)quinolin-8-amine. InChIKey: JWTQKVKKARCGCQ-UHFFFAOYSA-N.
| Molecular formula | C10H8F2N2O |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | 5-(difluoromethoxy)quinolin-8-amine |
| InChIKey | JWTQKVKKARCGCQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2N=C1)N)OC(F)F |
Computed by PubChem (NCBI)