CAS 15944-33-9 appears in our catalog under these names: 7-Chloro-1,8-naphthyridin-2-amine, 95%, 7-chloro-1,8-naphthyridin-2-amine, 2-Amino-7-chloro-1,8-naphthyridine 95%, 2-Amino-7-chloro-1,8-naphthyridine, 98%, 98%, 2-Amino-7-chloro-1,8-naphthyridine, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 10g, 100mg, 5g.
7-chloro-1,8-naphthyridin-2-amine (CAS 15944-33-9) is a chemical compound with the molecular formula C8H6ClN3 and a molecular weight of 179.60 g/mol. IUPAC name: 7-chloro-1,8-naphthyridin-2-amine. InChIKey: HRXBYPUUCBEZAS-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3 |
|---|---|
| Molecular weight | 179.60 g/mol |
| IUPAC name | 7-chloro-1,8-naphthyridin-2-amine |
| InChIKey | HRXBYPUUCBEZAS-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1C=CC(=N2)Cl)N |
Computed by PubChem (NCBI)