CAS 5096-76-4 is the registry number for 3-Chloro-6-(1H-pyrrol-1-yl)pyridazine, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 25g, 5g.
3-chloro-6-pyrrol-1-ylpyridazine (CAS 5096-76-4) is a chemical compound with the molecular formula C8H6ClN3 and a molecular weight of 179.60 g/mol. IUPAC name: 3-chloro-6-pyrrol-1-ylpyridazine. InChIKey: LQIVORYEWIDSDK-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3 |
|---|---|
| Molecular weight | 179.60 g/mol |
| IUPAC name | 3-chloro-6-pyrrol-1-ylpyridazine |
| InChIKey | LQIVORYEWIDSDK-UHFFFAOYSA-N |
| SMILES | C1=CN(C=C1)C2=NN=C(C=C2)Cl |
Computed by PubChem (NCBI)