CAS 56015-92-0 appears in our catalog under these names: 3-(2-Chlorophenyl)-4H-1,2,4-triazole, 98%, 5-(2-Chlorophenyl)-1H-1,2,4-triazole, 98%, 3-(2-Chlorophenyl)-4H-1,2,4-triazole, 95%, 5-(2-Chlorophenyl)-1H-1,2,4-triazole. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 10g, 5g, 25g.
5-(2-chlorophenyl)-1H-1,2,4-triazole (CAS 56015-92-0) is a chemical compound with the molecular formula C8H6ClN3 and a molecular weight of 179.60 g/mol. IUPAC name: 5-(2-chlorophenyl)-1H-1,2,4-triazole. InChIKey: HUJUBANPLITKPV-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3 |
|---|---|
| Molecular weight | 179.60 g/mol |
| IUPAC name | 5-(2-chlorophenyl)-1H-1,2,4-triazole |
| InChIKey | HUJUBANPLITKPV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC=NN2)Cl |
Computed by PubChem (NCBI)