CAS 52853-74-4 appears in our catalog under these names: 3-(3-Chlorophenyl)-1,2,4-triazole, 98%, 3-(3-Chlorophenyl)-1,2,4-triazole, 96%, 96%, 3-(3-chlorophenyl)-4H-1,2,4-triazole, 96%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 100mg, 250mg, 10g.
5-(3-chlorophenyl)-1H-1,2,4-triazole (CAS 52853-74-4) is a chemical compound with the molecular formula C8H6ClN3 and a molecular weight of 179.60 g/mol. IUPAC name: 5-(3-chlorophenyl)-1H-1,2,4-triazole. InChIKey: RCYNSIUZTQULBK-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3 |
|---|---|
| Molecular weight | 179.60 g/mol |
| IUPAC name | 5-(3-chlorophenyl)-1H-1,2,4-triazole |
| InChIKey | RCYNSIUZTQULBK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=NC=NN2 |
Computed by PubChem (NCBI)