Products 15962-49-9
CAS 15962-49-9 is the registry number for (S)-Ethyl 2-amino-2-phenylacetate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
Ethyl (2S)-2-amino-2-phenylacetate (CAS 15962-49-9) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: ethyl (2S)-2-amino-2-phenylacetate. InChIKey: VWKGPFHYXWGWEI-VIFPVBQESA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | ethyl (2S)-2-amino-2-phenylacetate |
| InChIKey | VWKGPFHYXWGWEI-VIFPVBQESA-N |
| SMILES | CCOC(=O)[C@H](C1=CC=CC=C1)N |
Computed by PubChem (NCBI)
Synonyms:
Ethyl phenylglycinate, L-, L-Phenylglycine ethyl ester, Ethyl phenylglycinate, (+)-, Ethyl (2S)-2-amino-2-(phenyl)ethanoate, Benzeneacetic acid, alpha-amino-, ethyl ester, (alphaS)-, BENZENEACETIC ACID, .ALPHA.-AMINO-, ETHYL ESTER, (.ALPHA.S)-, ethyl (2S)-2-amino-2-phenylacetate, (S)-ALPHA-AMINOBENZENEACETIC ACID ETHYL ESTER, L-ethyl phenylglycinate, ethyl (2s)-amino(phenyl)acetate