CAS 159681-93-3 is the registry number for Fmoc-D-Thr(Psi(Me,Me)Pro)-OH. Offered by: Iris Biotech. Available pack sizes: 1g, 5g, 25g.
(4R,5S)-3-(9H-fluoren-9-ylmethoxycarbonyl)-2,2,5-trimethyl-1,3-oxazolidine-4-carboxylic acid (CAS 159681-93-3) is a chemical compound with the molecular formula C22H23NO5 and a molecular weight of 381.4 g/mol. IUPAC name: (4R,5S)-3-(9H-fluoren-9-ylmethoxycarbonyl)-2,2,5-trimethyl-1,3-oxazolidine-4-carboxylic acid. InChIKey: AWTLACWXIZNIRV-ORAYPTAESA-N.
| Molecular formula | C22H23NO5 |
|---|---|
| Molecular weight | 381.4 g/mol |
| IUPAC name | (4R,5S)-3-(9H-fluoren-9-ylmethoxycarbonyl)-2,2,5-trimethyl-1,3-oxazolidine-4-carboxylic acid |
| InChIKey | AWTLACWXIZNIRV-ORAYPTAESA-N |
| SMILES | C[C@H]1[C@@H](N(C(O1)(C)C)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)