Products 2023823-19-8
CAS 2023823-19-8 appears in our catalog under these names: Fmoc-L-Thr(Psi(Me,Me)Pro)-OH, Fmoc-Thr(Psi(Me,Me)Pro)-OH 98%. Offered by: Iris Biotech, Ambeed. Available pack sizes: 5g, 25g, 100mg, 250mg, 1g.
(4S,5R)-3-(9H-fluoren-9-ylmethoxycarbonyl)-2,2,5-trimethyl-1,3-oxazolidine-4-carboxylic acid (CAS 2023823-19-8) is a chemical compound with the molecular formula C22H23NO5 and a molecular weight of 381.4 g/mol. IUPAC name: (4S,5R)-3-(9H-fluoren-9-ylmethoxycarbonyl)-2,2,5-trimethyl-1,3-oxazolidine-4-carboxylic acid. InChIKey: AWTLACWXIZNIRV-YJYMSZOUSA-N.
| Molecular formula | C22H23NO5 |
|---|---|
| Molecular weight | 381.4 g/mol |
| IUPAC name | (4S,5R)-3-(9H-fluoren-9-ylmethoxycarbonyl)-2,2,5-trimethyl-1,3-oxazolidine-4-carboxylic acid |
| InChIKey | AWTLACWXIZNIRV-YJYMSZOUSA-N |
| SMILES | C[C@@H]1[C@H](N(C(O1)(C)C)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)