CAS 159730-14-0 is the registry number for 2-(5,7-Difluoro-1H-Indol-3-Yl)Ethanamine Hydrochloride (1:1). Offered by: Biosynth. Available pack sizes: 0,5g, 0,25g, 1g, 2g.
2-(5,7-difluoro-1H-indol-3-yl)ethanamine;hydrochloride (CAS 159730-14-0) is a chemical compound with the molecular formula C10H11ClF2N2 and a molecular weight of 232.66 g/mol. IUPAC name: 2-(5,7-difluoro-1H-indol-3-yl)ethanamine;hydrochloride. InChIKey: LYCXIRODMNCMJW-UHFFFAOYSA-N.
| Molecular formula | C10H11ClF2N2 |
|---|---|
| Molecular weight | 232.66 g/mol |
| IUPAC name | 2-(5,7-difluoro-1H-indol-3-yl)ethanamine;hydrochloride |
| InChIKey | LYCXIRODMNCMJW-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=CN2)CCN)F)F.Cl |
Computed by PubChem (NCBI)