Products 1935305-98-8
CAS 1935305-98-8 is the registry number for 2-Chloro-5-[(3,3-difluoropyrrolidin-1-yl)methyl]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-chloro-5-[(3,3-difluoropyrrolidin-1-yl)methyl]pyridine (CAS 1935305-98-8) is a chemical compound with the molecular formula C10H11ClF2N2 and a molecular weight of 232.66 g/mol. IUPAC name: 2-chloro-5-[(3,3-difluoropyrrolidin-1-yl)methyl]pyridine. InChIKey: UANLOIJDMSGOSD-UHFFFAOYSA-N.
| Molecular formula | C10H11ClF2N2 |
|---|---|
| Molecular weight | 232.66 g/mol |
| IUPAC name | 2-chloro-5-[(3,3-difluoropyrrolidin-1-yl)methyl]pyridine |
| InChIKey | UANLOIJDMSGOSD-UHFFFAOYSA-N |
| SMILES | C1CN(CC1(F)F)CC2=CN=C(C=C2)Cl |
Computed by PubChem (NCBI)