CAS 2044713-90-6 is the registry number for 2-(5,6-Difluoro-1H-indol-3-yl)ethan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(5,6-difluoro-1H-indol-3-yl)ethanamine;hydrochloride (CAS 2044713-90-6) is a chemical compound with the molecular formula C10H11ClF2N2 and a molecular weight of 232.66 g/mol. IUPAC name: 2-(5,6-difluoro-1H-indol-3-yl)ethanamine;hydrochloride. InChIKey: YSVNVDVGTVGPAR-UHFFFAOYSA-N.
| Molecular formula | C10H11ClF2N2 |
|---|---|
| Molecular weight | 232.66 g/mol |
| IUPAC name | 2-(5,6-difluoro-1H-indol-3-yl)ethanamine;hydrochloride |
| InChIKey | YSVNVDVGTVGPAR-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1F)F)NC=C2CCN.Cl |
Computed by PubChem (NCBI)