CAS 2094162-94-2 is the registry number for 2-(4,6-Difluoro-1H-indol-3-yl)ethan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,01g, 0,025g, 0,05g, 0,25g, 0,1g.
2-(4,6-difluoro-1H-indol-3-yl)ethanamine;hydrochloride (CAS 2094162-94-2) is a chemical compound with the molecular formula C10H11ClF2N2 and a molecular weight of 232.66 g/mol. IUPAC name: 2-(4,6-difluoro-1H-indol-3-yl)ethanamine;hydrochloride. InChIKey: YDDREHHCEHNEIU-UHFFFAOYSA-N.
| Molecular formula | C10H11ClF2N2 |
|---|---|
| Molecular weight | 232.66 g/mol |
| IUPAC name | 2-(4,6-difluoro-1H-indol-3-yl)ethanamine;hydrochloride |
| InChIKey | YDDREHHCEHNEIU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1NC=C2CCN)F)F.Cl |
Computed by PubChem (NCBI)