Products 2094162-94-2

CAS 2094162-94-2 is the registry number for 2-(4,6-Difluoro-1H-indol-3-yl)ethan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,01g, 0,025g, 0,05g, 0,25g, 0,1g.

Structural formula: {0} (CAS {1})

2-(4,6-difluoro-1H-indol-3-yl)ethanamine;hydrochloride (CAS 2094162-94-2) is a chemical compound with the molecular formula C10H11ClF2N2 and a molecular weight of 232.66 g/mol. IUPAC name: 2-(4,6-difluoro-1H-indol-3-yl)ethanamine;hydrochloride. InChIKey: YDDREHHCEHNEIU-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11ClF2N2
Molecular weight232.66 g/mol
IUPAC name2-(4,6-difluoro-1H-indol-3-yl)ethanamine;hydrochloride
InChIKeyYDDREHHCEHNEIU-UHFFFAOYSA-N
SMILESC1=C(C=C(C2=C1NC=C2CCN)F)F.Cl

Computed by PubChem (NCBI)