CAS 1598490-95-9 appears in our catalog under these names: Methyl 6-iodoquinoline-2-carboxylate, 95%, Methyl 6-iodoquinoline-2-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Methyl 6-iodoquinoline-2-carboxylate (CAS 1598490-95-9) is a chemical compound with the molecular formula C11H8INO2 and a molecular weight of 313.09 g/mol. IUPAC name: methyl 6-iodoquinoline-2-carboxylate. InChIKey: SSWWTQVMENCIJA-UHFFFAOYSA-N.
| Molecular formula | C11H8INO2 |
|---|---|
| Molecular weight | 313.09 g/mol |
| IUPAC name | methyl 6-iodoquinoline-2-carboxylate |
| InChIKey | SSWWTQVMENCIJA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC2=C(C=C1)C=C(C=C2)I |
Computed by PubChem (NCBI)