CAS 2629357-58-8 is the registry number for 2-Hydroxy-3-iodo-5-oxo-5,6,7,8-tetrahydronaphthalene-1-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-hydroxy-3-iodo-5-oxo-7,8-dihydro-6H-naphthalene-1-carbonitrile (CAS 2629357-58-8) is a chemical compound with the molecular formula C11H8INO2 and a molecular weight of 313.09 g/mol. IUPAC name: 2-hydroxy-3-iodo-5-oxo-7,8-dihydro-6H-naphthalene-1-carbonitrile. InChIKey: XULUIUQIKJZOGU-UHFFFAOYSA-N.
| Molecular formula | C11H8INO2 |
|---|---|
| Molecular weight | 313.09 g/mol |
| IUPAC name | 2-hydroxy-3-iodo-5-oxo-7,8-dihydro-6H-naphthalene-1-carbonitrile |
| InChIKey | XULUIUQIKJZOGU-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=C(C=C2C(=O)C1)I)O)C#N |
Computed by PubChem (NCBI)