Products 1644061-87-9
CAS 1644061-87-9 is the registry number for Rivaroxaban Impurity 118. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(E)-3-iodoprop-2-enyl]isoindole-1,3-dione (CAS 1644061-87-9) is a chemical compound with the molecular formula C11H8INO2 and a molecular weight of 313.09 g/mol. IUPAC name: 2-[(E)-3-iodoprop-2-enyl]isoindole-1,3-dione. InChIKey: SPLNWOPVXYLCJH-ZZXKWVIFSA-N.
| Molecular formula | C11H8INO2 |
|---|---|
| Molecular weight | 313.09 g/mol |
| IUPAC name | 2-[(E)-3-iodoprop-2-enyl]isoindole-1,3-dione |
| InChIKey | SPLNWOPVXYLCJH-ZZXKWVIFSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)C/C=C/I |
Computed by PubChem (NCBI)