CAS 433244-12-3 appears in our catalog under these names: 6-Iodo-2-methylquinoline-4-carboxylic acid, 95+%, 6-iodo-2-methylquinoline-4-carboxylic acid, 95%. Offered by: Chemat Brand, Fluorochem. Available pack sizes: on request, 250mg, 1g.
6-iodo-2-methylquinoline-4-carboxylic acid (CAS 433244-12-3) is a chemical compound with the molecular formula C11H8INO2 and a molecular weight of 313.09 g/mol. IUPAC name: 6-iodo-2-methylquinoline-4-carboxylic acid. InChIKey: GBYQKIVJBNZXTF-UHFFFAOYSA-N.
| Molecular formula | C11H8INO2 |
|---|---|
| Molecular weight | 313.09 g/mol |
| IUPAC name | 6-iodo-2-methylquinoline-4-carboxylic acid |
| InChIKey | GBYQKIVJBNZXTF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C=C(C=CC2=N1)I)C(=O)O |
Computed by PubChem (NCBI)