Products 159853-36-8
CAS 159853-36-8 is the registry number for 4'-O-Methylirenolone. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-hydroxy-4-(4-methoxyphenyl)phenalen-1-one (CAS 159853-36-8) is a chemical compound with the molecular formula C20H14O3 and a molecular weight of 302.3 g/mol. IUPAC name: 2-hydroxy-4-(4-methoxyphenyl)phenalen-1-one. InChIKey: PVZKBQMWQRUUFI-UHFFFAOYSA-N.
| Molecular formula | C20H14O3 |
|---|---|
| Molecular weight | 302.3 g/mol |
| IUPAC name | 2-hydroxy-4-(4-methoxyphenyl)phenalen-1-one |
| InChIKey | PVZKBQMWQRUUFI-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C3C=C(C(=O)C4=CC=CC(=C43)C=C2)O |
Computed by PubChem (NCBI)