CAS 159877-49-3 is the registry number for (R)-3-[[(1,1-Dimethylethoxy)carbonyl]amino]butanethioamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl N-[(2R)-4-amino-4-sulfanylidenebutan-2-yl]carbamate (CAS 159877-49-3) is a chemical compound with the molecular formula C9H18N2O2S and a molecular weight of 218.32 g/mol. IUPAC name: tert-butyl N-[(2R)-4-amino-4-sulfanylidenebutan-2-yl]carbamate. InChIKey: FQLWLAQLAPCVFC-ZCFIWIBFSA-N.
| Molecular formula | C9H18N2O2S |
|---|---|
| Molecular weight | 218.32 g/mol |
| IUPAC name | tert-butyl N-[(2R)-4-amino-4-sulfanylidenebutan-2-yl]carbamate |
| InChIKey | FQLWLAQLAPCVFC-ZCFIWIBFSA-N |
| SMILES | C[C@H](CC(=S)N)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)