CAS 1865262-69-6 is the registry number for 3-(3,3-Dimethylpiperazin-1-yl)thietane 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3,3-dimethylpiperazin-1-yl)thietane 1,1-dioxide (CAS 1865262-69-6) is a chemical compound with the molecular formula C9H18N2O2S and a molecular weight of 218.32 g/mol. IUPAC name: 3-(3,3-dimethylpiperazin-1-yl)thietane 1,1-dioxide. InChIKey: FXROCMUFYLCUHI-UHFFFAOYSA-N.
| Molecular formula | C9H18N2O2S |
|---|---|
| Molecular weight | 218.32 g/mol |
| IUPAC name | 3-(3,3-dimethylpiperazin-1-yl)thietane 1,1-dioxide |
| InChIKey | FXROCMUFYLCUHI-UHFFFAOYSA-N |
| SMILES | CC1(CN(CCN1)C2CS(=O)(=O)C2)C |
Computed by PubChem (NCBI)