CAS 1600818-89-0 is the registry number for 4-(1-Imino-2-methylpropyl)-3-methylthiomorpholine 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methyl-1-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)propan-1-imine (CAS 1600818-89-0) is a chemical compound with the molecular formula C9H18N2O2S and a molecular weight of 218.32 g/mol. IUPAC name: 2-methyl-1-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)propan-1-imine. InChIKey: YFIMURUADKVQDT-UHFFFAOYSA-N.
| Molecular formula | C9H18N2O2S |
|---|---|
| Molecular weight | 218.32 g/mol |
| IUPAC name | 2-methyl-1-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)propan-1-imine |
| InChIKey | YFIMURUADKVQDT-UHFFFAOYSA-N |
| SMILES | CC1CS(=O)(=O)CCN1C(=N)C(C)C |
Computed by PubChem (NCBI)