CAS 1599276-16-0 is the registry number for 1-Bromo-4-(bromomethyl)-2-chloro-5-fluorobenzene, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-bromo-4-(bromomethyl)-2-chloro-5-fluorobenzene (CAS 1599276-16-0) is a chemical compound with the molecular formula C7H4Br2ClF and a molecular weight of 302.36 g/mol. IUPAC name: 1-bromo-4-(bromomethyl)-2-chloro-5-fluorobenzene. InChIKey: CMPHDESTHVJRLA-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2ClF |
|---|---|
| Molecular weight | 302.36 g/mol |
| IUPAC name | 1-bromo-4-(bromomethyl)-2-chloro-5-fluorobenzene |
| InChIKey | CMPHDESTHVJRLA-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)Br)F)CBr |
Computed by PubChem (NCBI)