CAS 2091710-10-8 is the registry number for 1-Bromo-4-(bromomethyl)-2-chloro-3-fluorobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
1-bromo-4-(bromomethyl)-2-chloro-3-fluorobenzene (CAS 2091710-10-8) is a chemical compound with the molecular formula C7H4Br2ClF and a molecular weight of 302.36 g/mol. IUPAC name: 1-bromo-4-(bromomethyl)-2-chloro-3-fluorobenzene. InChIKey: LIQFLOWKEMRBPJ-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2ClF |
|---|---|
| Molecular weight | 302.36 g/mol |
| IUPAC name | 1-bromo-4-(bromomethyl)-2-chloro-3-fluorobenzene |
| InChIKey | LIQFLOWKEMRBPJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1CBr)F)Cl)Br |
Computed by PubChem (NCBI)