Products 1823559-40-5
CAS 1823559-40-5 appears in our catalog under these names: 2-Bromo-3-chloro-6-fluorobenzyl bromide, 95%, 2-Bromo-3-chloro-6-fluorobenzyl bromide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-bromo-3-(bromomethyl)-1-chloro-4-fluorobenzene (CAS 1823559-40-5) is a chemical compound with the molecular formula C7H4Br2ClF and a molecular weight of 302.36 g/mol. IUPAC name: 2-bromo-3-(bromomethyl)-1-chloro-4-fluorobenzene. InChIKey: RQDJVCIJSLHGRC-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2ClF |
|---|---|
| Molecular weight | 302.36 g/mol |
| IUPAC name | 2-bromo-3-(bromomethyl)-1-chloro-4-fluorobenzene |
| InChIKey | RQDJVCIJSLHGRC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)CBr)Br)Cl |
Computed by PubChem (NCBI)