CAS 886615-32-3 appears in our catalog under these names: 3–Bromo–6–chloro–2–fluorobenzyl bromide, 3-Bromo-6-chloro-2-fluorobenzyl bromide, 3-Bromo-6-chloro-2-fluorobenzyl bromide 97%. Offered by: GLPBio, Biosynth, Ambeed. Available pack sizes: 100mg, 5g, 0,5g, 250mg, 1g.
1-bromo-3-(bromomethyl)-4-chloro-2-fluorobenzene (CAS 886615-32-3) is a chemical compound with the molecular formula C7H4Br2ClF and a molecular weight of 302.36 g/mol. IUPAC name: 1-bromo-3-(bromomethyl)-4-chloro-2-fluorobenzene. InChIKey: NXGGPRJWFMRICP-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2ClF |
|---|---|
| Molecular weight | 302.36 g/mol |
| IUPAC name | 1-bromo-3-(bromomethyl)-4-chloro-2-fluorobenzene |
| InChIKey | NXGGPRJWFMRICP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1Cl)CBr)F)Br |
Computed by PubChem (NCBI)