CAS 1600878-75-8 appears in our catalog under these names: 3-(Pyrimidin-2-yl)isoxazol-5-amine, 98%, 3-(pyrimidin-2-yl)-1,2-oxazol-5-amine, ≥95%, ≥95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg.
3-pyrimidin-2-yl-1,2-oxazol-5-amine (CAS 1600878-75-8) is a chemical compound with the molecular formula C7H6N4O and a molecular weight of 162.15 g/mol. IUPAC name: 3-pyrimidin-2-yl-1,2-oxazol-5-amine. InChIKey: UNNPTMVNMJPGTH-UHFFFAOYSA-N.
| Molecular formula | C7H6N4O |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 3-pyrimidin-2-yl-1,2-oxazol-5-amine |
| InChIKey | UNNPTMVNMJPGTH-UHFFFAOYSA-N |
| SMILES | C1=CN=C(N=C1)C2=NOC(=C2)N |
Computed by PubChem (NCBI)