CAS 160169-32-4 is the registry number for (S)-N-(2-(2,6-dimethylphenoxy)-1-methylethyl)acetamide. Offered by: TRC. Available pack sizes: 2,5g.
N-[(2S)-1-(2,6-dimethylphenoxy)propan-2-yl]acetamide (CAS 160169-32-4) is a chemical compound with the molecular formula C13H19NO2 and a molecular weight of 221.29 g/mol. IUPAC name: N-[(2S)-1-(2,6-dimethylphenoxy)propan-2-yl]acetamide. InChIKey: DNSFMKGQWLZMOJ-NSHDSACASA-N.
| Molecular formula | C13H19NO2 |
|---|---|
| Molecular weight | 221.29 g/mol |
| IUPAC name | N-[(2S)-1-(2,6-dimethylphenoxy)propan-2-yl]acetamide |
| InChIKey | DNSFMKGQWLZMOJ-NSHDSACASA-N |
| SMILES | CC1=C(C(=CC=C1)C)OC[C@H](C)NC(=O)C |
Computed by PubChem (NCBI)